netoisbeautiful6887 netoisbeautiful6887
  • 04-06-2018
  • Mathematics
contestada

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Respuesta :

Аноним Аноним
  • 04-06-2018
We use the identity  sin (A - B) = sin A cos B - cos B sin A

so the above  = sin (11pi/12 -  pi/6) = sin 3pi/4 =  1 / sqrt2 answer
Answer Link

Otras preguntas

How can b^2+9b+14 be re-written?1) (b+7) (b-7)2) (b-7) (b-2)3) (b+7) (b-2)4) (b+7) (b+2)
What is the value of x in 15x-10= 20
1. What is the respiratory structure of a millipede? A. book lungs B. tracheal tube C. gill slits 2. what is the respiratory structure of a spider? A. gills B.
how many books did Harriet beecher stowe write?
how do i round 3,176 to the nearest thousand
A mouse population starts with 2,000 mice and grows at a rate of 5% per year. The number of mice after t years can be modeled by the equation, P(t)=2000(1.05)^t
do you know how to say my in Spanish?
An ant sits on the back of a mouse. The mouse carries the ant across the floor for a distance of 10 meters. Was there work done by the mouse? Explain.
what does the zeppelin
How many heart chambers does a shark have?