jtkgotosleep123 jtkgotosleep123

01-12-2020
Mathematics

contestada

what is the exact value of cos(11pi/21)cos(pi/7)-sin(11pi/21)sin(pi/7)?

a. -squr3/2
b. -1/2
c. 1/2
d. squr3/2

Respuesta :

funnymunchies2004 funnymunchies2004

07-12-2020

Answer:

B

Step-by-step explanation:

-1/2

Answer Link

camjjwo camjjwo

12-06-2021

Answer:

B -1/2

Step-by-step explanation:

Answer Link

Otras preguntas

Ammonia can be made from the reaction N2(g) + 3 H2(g) 2 NH3(g). The reaction quotient is Q = 4.50 x 10-4 and Keq = 6.02 x 10-2. What statement can be made abou

What did the Aztec settle where they did?

What is the purpose of reading the interview with

The following box-and-whisker plot shows the distribution of ratings a new restaurant received from 100 food critics that reviewed it. Seventy-five percent of c

The measured engine fuel flow rate is 0.4g/s, airflow rate is 5.6 g/s and exhaust gas composition (measured dry) is CO2 =13.0% , CO = 2.8% with O2 essentially z

Barney, an admissions officer, is interviewing a college applicant about whom he has very high positive expectations. Barney is outgoing and cheerful during the

What are the only two liquids that violate the principle of greater density at temperatures near their freezing points?

Explain how to solve 5x^2-3x=25 by completing the square. What are the solutions? ((You'll get 35 points for this)) (I need a good explanation to help me unders

Which location has the least elevation?

BRAINLIEST QUESTION In the diagram below, AB and DE are parallel. Which of the following statements must be true? A.) ∠C is a right angle B.) ∠D and ∠E are con