rexkatflHbp rexkatflHbp
  • 02-11-2016
  • Mathematics
contestada

One number is three more than the other. their sum is thirty three. find the numbers

Respuesta :

JulieC246
JulieC246 JulieC246
  • 03-11-2016
The numbers are 15,18
They add to 33 and a difference of 3
Answer Link

Otras preguntas

the local amusement park charges $18.95 per person. However , after 5PM the charge is reduced to $14.45 per person.A group of 4 adults is planning to go to the
In a titration experiment a student uses 1.4 m hbr solution and the indicator phenolphthalein to determine the concentration of a koh solution.
is the answer a, b, c, or d.
Why did Douglass consider religion and slavery a bad mix
CH3CO2H(aq) + H2O(l) ⇄ CH3CO2-(aq) + H3O+(l) As acetic acid dissolves in water, the acetate ion and hydroniium ion are produced. Predict the direction that t
What did the family do to force Juliet to married Paris
A bakery sold apple pies for $12 and blueberry pies for $14. One Saturday they sold a total of 41 pies and collected a total of $536. How many apple pies did th
What's a stock? A. A way to trade farm goods B. A trade tactic used by nations C. An economic downturn D. Share of ownership in a company
Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)
what is a chemical bond